C20H25N3O — CID 56875104
4-benzyl-3-ethyl-1-(pyridin-3-ylmethyl)-1,4-diazepan-5-one (PubChem CID 56875104) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(pyridin-3-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(pyridin-3-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56875104 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(pyridin-3-ylmethyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(Cc2cccnc2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H25N3O/c1-2-19-16-22(14-18-9-6-11-21-13-18)12-10-20(24)23(19)15-17-7-4-3-5-8-17/h3-9,11,13,19H,2,10,12,14-16H2,1H3 |
| InChIKey | QYRJFTKTBMCHLT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |