C18H25F3N2O — CID 56862102
4-benzyl-3-ethyl-1-(4,4,4-trifluorobutyl)-1,4-diazepan-5-one (PubChem CID 56862102) has the molecular formula C18H25F3N2O and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(4,4,4-trifluorobutyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(4,4,4-trifluorobutyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56862102 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(4,4,4-trifluorobutyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(CCCC(F)(F)F)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H25F3N2O/c1-2-16-14-22(11-6-10-18(19,20)21)12-9-17(24)23(16)13-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14H2,1H3 |
| InChIKey | FEPDDOZZSABGNH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |