C19H26N2O2 — CID 95402573
(3S)-4-benzyl-1-(cyclobutanecarbonyl)-3-ethyl-1,4-diazepan-5-one (PubChem CID 95402573) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S)-4-benzyl-1-(cyclobutanecarbonyl)-3-ethyl-1,4-diazepan-5-one.
| Compound Name | (3S)-4-benzyl-1-(cyclobutanecarbonyl)-3-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95402573 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (3S)-4-benzyl-1-(cyclobutanecarbonyl)-3-ethyl-1,4-diazepan-5-one |
| SMILES | CC[C@H]1CN(C(=O)C2CCC2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-2-17-14-20(19(23)16-9-6-10-16)12-11-18(22)21(17)13-15-7-4-3-5-8-15/h3-5,7-8,16-17H,2,6,9-14H2,1H3/t17-/m0/s1 |
| InChIKey | JSPHATKBZJGZHR-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |