C19H23N3O2 — CID 56874335
4-benzyl-3-ethyl-1-(1H-pyrrole-2-carbonyl)-1,4-diazepan-5-one (PubChem CID 56874335) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(1H-pyrrole-2-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(1H-pyrrole-2-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56874335 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(1H-pyrrole-2-carbonyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(C(=O)c2ccc[nH]2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-16-14-21(19(24)17-9-6-11-20-17)12-10-18(23)22(16)13-15-7-4-3-5-8-15/h3-9,11,16,20H,2,10,12-14H2,1H3 |
| InChIKey | NZYSNDNOTJXBNJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |