C21H26N4O2 — CID 95551067
(3R)-4-benzyl-3-ethyl-1-(2-ethylpyrimidine-5-carbonyl)-1,4-diazepan-5-one (PubChem CID 95551067) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (3R)-4-benzyl-3-ethyl-1-(2-ethylpyrimidine-5-carbonyl)-1,4-diazepan-5-one.
| Compound Name | (3R)-4-benzyl-3-ethyl-1-(2-ethylpyrimidine-5-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95551067 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3R)-4-benzyl-3-ethyl-1-(2-ethylpyrimidine-5-carbonyl)-1,4-diazepan-5-one |
| SMILES | CCc1ncc(C(=O)N2CCC(=O)N(Cc3ccccc3)[C@H](CC)C2)cn1 |
| InChI | InChI=1S/C21H26N4O2/c1-3-18-15-24(21(27)17-12-22-19(4-2)23-13-17)11-10-20(26)25(18)14-16-8-6-5-7-9-16/h5-9,12-13,18H,3-4,10-11,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | CXADLLHHIVSIGK-GOSISDBHSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |