C20H22ClN3O2 — CID 95550865
(3R)-4-benzyl-1-(2-chloropyridine-4-carbonyl)-3-ethyl-1,4-diazepan-5-one (PubChem CID 95550865) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is (3R)-4-benzyl-1-(2-chloropyridine-4-carbonyl)-3-ethyl-1,4-diazepan-5-one.
| Compound Name | (3R)-4-benzyl-1-(2-chloropyridine-4-carbonyl)-3-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95550865 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3R)-4-benzyl-1-(2-chloropyridine-4-carbonyl)-3-ethyl-1,4-diazepan-5-one |
| SMILES | CC[C@@H]1CN(C(=O)c2ccnc(Cl)c2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-2-17-14-23(20(26)16-8-10-22-18(21)12-16)11-9-19(25)24(17)13-15-6-4-3-5-7-15/h3-8,10,12,17H,2,9,11,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | YXJYIBGMAOEVJP-QGZVFWFLSA-N |
| XLogP | 3.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|