C21H25N3O2 — CID 56874142
4-benzyl-3-ethyl-1-(5-methylpyridine-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 56874142) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(5-methylpyridine-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(5-methylpyridine-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56874142 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(5-methylpyridine-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(C(=O)c2cncc(C)c2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-19-15-23(21(26)18-11-16(2)12-22-13-18)10-9-20(25)24(19)14-17-7-5-4-6-8-17/h4-8,11-13,19H,3,9-10,14-15H2,1-2H3 |
| InChIKey | PNTLOYRKVMNRFS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |