C22H26N2O4 — CID 95551973
(3R)-4-benzyl-3-ethyl-1-(4-hydroxy-3-methoxybenzoyl)-1,4-diazepan-5-one (PubChem CID 95551973) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (3R)-4-benzyl-3-ethyl-1-(4-hydroxy-3-methoxybenzoyl)-1,4-diazepan-5-one.
| Compound Name | (3R)-4-benzyl-3-ethyl-1-(4-hydroxy-3-methoxybenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95551973 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (3R)-4-benzyl-3-ethyl-1-(4-hydroxy-3-methoxybenzoyl)-1,4-diazepan-5-one |
| SMILES | CC[C@@H]1CN(C(=O)c2ccc(O)c(OC)c2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-3-18-15-23(22(27)17-9-10-19(25)20(13-17)28-2)12-11-21(26)24(18)14-16-7-5-4-6-8-16/h4-10,13,18,25H,3,11-12,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | FBCZVPCPVGMIDZ-GOSISDBHSA-N |
| XLogP | 3.05 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |