C21H29N3O3 — CID 95401387
2-[(3S)-4-benzyl-3-ethyl-5-oxo-1,4-diazepan-1-yl]-N-cyclopentyl-2-oxoacetamide (PubChem CID 95401387) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[(3S)-4-benzyl-3-ethyl-5-oxo-1,4-diazepan-1-yl]-N-cyclopentyl-2-oxoacetamide.
| Compound Name | 2-[(3S)-4-benzyl-3-ethyl-5-oxo-1,4-diazepan-1-yl]-N-cyclopentyl-2-oxoacetamide |
|---|---|
| PubChem CID | 95401387 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[(3S)-4-benzyl-3-ethyl-5-oxo-1,4-diazepan-1-yl]-N-cyclopentyl-2-oxoacetamide |
| SMILES | CC[C@H]1CN(C(=O)C(=O)NC2CCCC2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-2-18-15-23(21(27)20(26)22-17-10-6-7-11-17)13-12-19(25)24(18)14-16-8-4-3-5-9-16/h3-5,8-9,17-18H,2,6-7,10-15H2,1H3,(H,22,26)/t18-/m0/s1 |
| InChIKey | HTBMAMMFBJMTGZ-SFHVURJKSA-N |
| XLogP | 2.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|