C21H25N3O3 — CID 56874579
4-benzyl-3-ethyl-1-(2-pyridin-3-yloxyacetyl)-1,4-diazepan-5-one (PubChem CID 56874579) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(2-pyridin-3-yloxyacetyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(2-pyridin-3-yloxyacetyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56874579 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(2-pyridin-3-yloxyacetyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(C(=O)COc2cccnc2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-18-15-23(21(26)16-27-19-9-6-11-22-13-19)12-10-20(25)24(18)14-17-7-4-3-5-8-17/h3-9,11,13,18H,2,10,12,14-16H2,1H3 |
| InChIKey | GBJZTSFEORDLGI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |