About 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline
3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 82156847) has the molecular formula C16H17F2N3
and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 82156847 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | CCC1CNc2cc(F)c(F)cc2N1Cc1cccnc1 |
| InChI | InChI=1S/C16H17F2N3/c1-2-12-9-20-15-6-13(17)14(18)7-16(15)21(12)10-11-4-3-5-19-8-11/h3-8,12,20H,2,9-10H2,1H3 |
| InChIKey | AWMFWSRLWMSGLN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline (CID 82156847) is 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline is CCC1CNc2cc(F)c(F)cc2N1Cc1cccnc1.
What is the InChIKey of 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline?
The InChIKey is AWMFWSRLWMSGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3/c1-2-12-9-20-15-6-13(17)14(18)7-16(15)21(12)10-11-4-3-5-19-8-11/h3-8,12,20H,2,9-10H2,1H3.
What are the key properties of 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline?
3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline has a molecular weight of 289.33 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,7-difluoro-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 82156847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).