C19H23NO6 — CID 102228287
1-O-benzyl 4-O-methyl 2-[(2-methylpropan-2-yl)oxymethyl]-3-oxo-2H-pyrrole-1,4-dicarboxylate (PubChem CID 102228287) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 1-O-benzyl 4-O-methyl 2-[(2-methylpropan-2-yl)oxymethyl]-3-oxo-2H-pyrrole-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-methyl 2-[(2-methylpropan-2-yl)oxymethyl]-3-oxo-2H-pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102228287 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-O-benzyl 4-O-methyl 2-[(2-methylpropan-2-yl)oxymethyl]-3-oxo-2H-pyrrole-1,4-dicarboxylate |
| SMILES | COC(=O)C1=CN(C(=O)OCc2ccccc2)C(COC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H23NO6/c1-19(2,3)26-12-15-16(21)14(17(22)24-4)10-20(15)18(23)25-11-13-8-6-5-7-9-13/h5-10,15H,11-12H2,1-4H3 |
| InChIKey | RRXWAFKSAWVAHQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|