C32H37NO5Si — CID 11519560
1-O-benzyl 6-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate (PubChem CID 11519560) has the molecular formula C32H37NO5Si and a molecular weight of 543.74 g/mol. Its IUPAC name is 1-O-benzyl 6-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate.
| Compound Name | 1-O-benzyl 6-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11519560 |
| Molecular Formula | C32H37NO5Si |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 1-O-benzyl 6-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
| SMILES | COC(=O)C1=CCC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H37NO5Si/c1-32(2,3)39(27-18-10-6-11-19-27,28-20-12-7-13-21-28)38-24-26-17-14-22-29(30(34)36-4)33(26)31(35)37-23-25-15-8-5-9-16-25/h5-13,15-16,18-22,26H,14,17,23-24H2,1-4H3/t26-/m0/s1 |
| InChIKey | YMBNOUNGAUDSQR-SANMLTNESA-N |
| XLogP | 5.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|