C17H25NO — CID 144683049
2-benzyl-1-propyl-2,3-dihydropyridin-4-one;ethane (PubChem CID 144683049) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-benzyl-1-propyl-2,3-dihydropyridin-4-one;ethane.
| Compound Name | 2-benzyl-1-propyl-2,3-dihydropyridin-4-one;ethane |
|---|---|
| PubChem CID | 144683049 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-benzyl-1-propyl-2,3-dihydropyridin-4-one;ethane |
| SMILES | CC.CCCN1C=CC(=O)CC1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO.C2H6/c1-2-9-16-10-8-15(17)12-14(16)11-13-6-4-3-5-7-13;1-2/h3-8,10,14H,2,9,11-12H2,1H3;1-2H3 |
| InChIKey | DCRLISRDWXIOBI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |