C13H16N2O2 — CID 139093059
(5S)-5-benzyl-1,4-dimethylpiperazine-2,3-dione (PubChem CID 139093059) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (5S)-5-benzyl-1,4-dimethylpiperazine-2,3-dione.
| Compound Name | (5S)-5-benzyl-1,4-dimethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 139093059 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (5S)-5-benzyl-1,4-dimethylpiperazine-2,3-dione |
| SMILES | CN1C[C@H](Cc2ccccc2)N(C)C(=O)C1=O |
| InChI | InChI=1S/C13H16N2O2/c1-14-9-11(15(2)13(17)12(14)16)8-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | LFHWLUVPWBMWCY-NSHDSACASA-N |
| XLogP | 0.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|