C23H22BrN3O7 — CID 72735096
(4-nitrophenyl)methyl (2S,5R,6S)-2-[(4-bromoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 72735096) has the molecular formula C23H22BrN3O7 and a molecular weight of 532.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,5R,6S)-2-[(4-bromoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,5R,6S)-2-[(4-bromoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 72735096 |
| Molecular Formula | C23H22BrN3O7 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,5R,6S)-2-[(4-bromoanilino)methyl]-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2[C@@H]1CC(=O)[C@@]2(CNc1ccc(Br)cc1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22BrN3O7/c1-13(28)20-18-10-19(29)23(26(18)21(20)30,12-25-16-6-4-15(24)5-7-16)22(31)34-11-14-2-8-17(9-3-14)27(32)33/h2-9,13,18,20,25,28H,10-12H2,1H3/t13-,18-,20-,23+/m1/s1 |
| InChIKey | OSSJYMRFNBAAPB-RILOUYRMSA-N |
| XLogP | 2.43 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|