C26H23N3O9 — CID 122231598
(4-nitrophenyl)methyl (2R,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(2-hydroxynaphthalen-1-yl)amino]oxy-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 122231598) has the molecular formula C26H23N3O9 and a molecular weight of 521.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(2-hydroxynaphthalen-1-yl)amino]oxy-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(2-hydroxynaphthalen-1-yl)amino]oxy-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 122231598 |
| Molecular Formula | C26H23N3O9 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(2-hydroxynaphthalen-1-yl)amino]oxy-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2[C@@H]1CC(=O)[C@@]2(ONc1c(O)ccc2ccccc12)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23N3O9/c1-14(30)22-19-12-21(32)26(28(19)24(22)33,25(34)37-13-15-6-9-17(10-7-15)29(35)36)38-27-23-18-5-3-2-4-16(18)8-11-20(23)31/h2-11,14,19,22,27,30-31H,12-13H2,1H3/t14-,19-,22-,26-/m1/s1 |
| InChIKey | URNPOEZPIHFWLT-QYCDSJJCSA-N |
| XLogP | 2.42 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|