C22H21N3O7S — CID 139675474
(4-nitrophenyl)methyl (3R,5R,6R)-3-methyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 139675474) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R,5R,6R)-3-methyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R,5R,6R)-3-methyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 139675474 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (4-nitrophenyl)methyl (3R,5R,6R)-3-methyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | CC1(C(=O)OCc2ccc([N+](=O)[O-])cc2)CN2C(=O)[C@@H](NC(=O)Cc3ccccc3)[C@H]2S1=O |
| InChI | InChI=1S/C22H21N3O7S/c1-22(21(28)32-12-15-7-9-16(10-8-15)25(29)30)13-24-19(27)18(20(24)33(22)31)23-17(26)11-14-5-3-2-4-6-14/h2-10,18,20H,11-13H2,1H3,(H,23,26)/t18-,20-,22?,33?/m1/s1 |
| InChIKey | LXFBJEJAKSPQPO-IMMBPIQXSA-N |
| XLogP | 1.05 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|