C31H28N6O7S — CID 54119937
(4-nitrophenyl)methyl (3R,5R,6R)-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 54119937) has the molecular formula C31H28N6O7S and a molecular weight of 628.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R,5R,6R)-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R,5R,6R)-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 54119937 |
| Molecular Formula | C31H28N6O7S |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | (4-nitrophenyl)methyl (3R,5R,6R)-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C[C@@](C(=O)OCc3ccc([N+](=O)[O-])cc3)(N3CCN(N=Cc4ccccc4)C3=O)S[C@H]12 |
| InChI | InChI=1S/C31H28N6O7S/c38-25(17-21-7-3-1-4-8-21)33-26-27(39)34-20-31(45-28(26)34,29(40)44-19-23-11-13-24(14-12-23)37(42)43)35-15-16-36(30(35)41)32-18-22-9-5-2-6-10-22/h1-14,18,26,28H,15-17,19-20H2,(H,33,38)/t26-,28-,31-/m1/s1 |
| InChIKey | NMYGWDOKANNHGR-GGKDAACMSA-N |
| XLogP | 2.75 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|