C26H23BN4O6S — CID 172965976
CID 172965976 (PubChem CID 172965976) has the molecular formula C26H23BN4O6S and a molecular weight of 530.37 g/mol.
| Compound Name | CID 172965976 |
|---|---|
| PubChem CID | 172965976 |
| Molecular Formula | C26H23BN4O6S |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@@]1(N2CCN(/N=C/c3ccccc3)C(=O)C2=O)CN2C(=O)[C@@H](CC(=O)Cc3ccccc3)[C@H]2S1 |
| InChI | InChI=1S/C26H23BN4O6S/c27-37-25(36)26(30-11-12-31(23(35)22(30)34)28-15-18-9-5-2-6-10-18)16-29-21(33)20(24(29)38-26)14-19(32)13-17-7-3-1-4-8-17/h1-10,15,20,24H,11-14,16H2/b28-15+/t20-,24-,26-/m1/s1 |
| InChIKey | KUSICDOXJMFXOK-MZVMLNRMSA-N |
| XLogP | 0.75 |
| TPSA | 116.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|