C20H18N4O5 — CID 54235959
(2R)-2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetic acid (PubChem CID 54235959) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is (2R)-2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 54235959 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2R)-2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetic acid |
| SMILES | O=C(O)[C@H](NC(=O)N1CCN(N=Cc2ccccc2)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O5/c25-17-18(26)24(21-13-14-7-3-1-4-8-14)12-11-23(17)20(29)22-16(19(27)28)15-9-5-2-6-10-15/h1-10,13,16H,11-12H2,(H,22,29)(H,27,28)/t16-/m1/s1 |
| InChIKey | QMOUTKHGDMSHOX-MRXNPFEDSA-N |
| XLogP | 1.23 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|