C23H22N6O8S — CID 57131346
(3S)-3-[[2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 57131346) has the molecular formula C23H22N6O8S and a molecular weight of 542.53 g/mol. Its IUPAC name is (3S)-3-[[2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | (3S)-3-[[2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 57131346 |
| Molecular Formula | C23H22N6O8S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | (3S)-3-[[2-[[4-(benzylideneamino)-2,3-dioxopiperazine-1-carbonyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | O=C(N[C@H]1CN(S(=O)(=O)O)C1=O)C(NC(=O)N1CCN(N=Cc2ccccc2)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H22N6O8S/c30-19(25-17-14-29(20(17)31)38(35,36)37)18(16-9-5-2-6-10-16)26-23(34)27-11-12-28(22(33)21(27)32)24-13-15-7-3-1-4-8-15/h1-10,13,17-18H,11-12,14H2,(H,25,30)(H,26,34)(H,35,36,37)/t17-,18?/m0/s1 |
| InChIKey | KNFSYMFMSIXIHV-ZENAZSQFSA-N |
| XLogP | -0.73 |
| TPSA | 185.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|