C18H19N5O7S2 — CID 21244591
3-[[2-[[2-(carbamoylamino)-2-thiophen-2-ylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 21244591) has the molecular formula C18H19N5O7S2 and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-[[2-[[2-(carbamoylamino)-2-thiophen-2-ylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[[2-(carbamoylamino)-2-thiophen-2-ylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21244591 |
| Molecular Formula | C18H19N5O7S2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 3-[[2-[[2-(carbamoylamino)-2-thiophen-2-ylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | NC(=O)NC(C(=O)NC(C(=O)NC1CN(S(=O)(=O)O)C1=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H19N5O7S2/c19-18(27)22-14(12-7-4-8-31-12)16(25)21-13(10-5-2-1-3-6-10)15(24)20-11-9-23(17(11)26)32(28,29)30/h1-8,11,13-14H,9H2,(H,20,24)(H,21,25)(H3,19,22,27)(H,28,29,30) |
| InChIKey | SCRSYBIPNDAMBD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|