C11H9Cl2N3O7S2 — CID 88627317
3-[[(2Z)-2-(2,2-dichloroacetyl)oxyimino-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 88627317) has the molecular formula C11H9Cl2N3O7S2 and a molecular weight of 430.25 g/mol. Its IUPAC name is 3-[[(2Z)-2-(2,2-dichloroacetyl)oxyimino-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[(2Z)-2-(2,2-dichloroacetyl)oxyimino-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88627317 |
| Molecular Formula | C11H9Cl2N3O7S2 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 3-[[(2Z)-2-(2,2-dichloroacetyl)oxyimino-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | O=C(NC1CN(S(=O)(=O)O)C1=O)/C(=N/OC(=O)C(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C11H9Cl2N3O7S2/c12-8(13)11(19)23-15-7(6-2-1-3-24-6)9(17)14-5-4-16(10(5)18)25(20,21)22/h1-3,5,8H,4H2,(H,14,17)(H,20,21,22)/b15-7+ |
| InChIKey | ZCEVLCARHUWJNR-VIZOYTHASA-N |
| XLogP | -0.07 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|