C12H16N4O6S2 — CID 15458133
(2S,3S)-3-[[(2Z)-2-(2-aminoethoxyimino)-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 15458133) has the molecular formula C12H16N4O6S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is (2S,3S)-3-[[(2Z)-2-(2-aminoethoxyimino)-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-3-[[(2Z)-2-(2-aminoethoxyimino)-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 15458133 |
| Molecular Formula | C12H16N4O6S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (2S,3S)-3-[[(2Z)-2-(2-aminoethoxyimino)-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](NC(=O)/C(=N/OCCN)c2cccs2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C12H16N4O6S2/c1-7-9(12(18)16(7)24(19,20)21)14-11(17)10(15-22-5-4-13)8-3-2-6-23-8/h2-3,6-7,9H,4-5,13H2,1H3,(H,14,17)(H,19,20,21)/b15-10+/t7-,9-/m0/s1 |
| InChIKey | HKUOEDFJURCCPH-QVILGYTCSA-N |
| XLogP | -1.05 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|