C19H23N7O7S2 — CID 123673373
3-[[2-[2-[4-(2-amino-2-iminoethyl)phenoxy]ethoxyimino]-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 123673373) has the molecular formula C19H23N7O7S2 and a molecular weight of 525.57 g/mol. Its IUPAC name is 3-[[2-[2-[4-(2-amino-2-iminoethyl)phenoxy]ethoxyimino]-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[2-[4-(2-amino-2-iminoethyl)phenoxy]ethoxyimino]-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 123673373 |
| Molecular Formula | C19H23N7O7S2 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 3-[[2-[2-[4-(2-amino-2-iminoethyl)phenoxy]ethoxyimino]-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | [H]/N=C(\N)Cc1ccc(OCCON=C(C(=O)NC2C(=O)N(S(=O)(=O)O)C2C)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C19H23N7O7S2/c1-10-15(18(28)26(10)35(29,30)31)24-17(27)16(13-9-34-19(22)23-13)25-33-7-6-32-12-4-2-11(3-5-12)8-14(20)21/h2-5,9-10,15H,6-8H2,1H3,(H3,20,21)(H2,22,23)(H,24,27)(H,29,30,31) |
| InChIKey | LVMHGUJLUPQJSK-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 223.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|