C19H23N7O6S2 — CID 156519643
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]-N-(1-hydroxysulfanyloxy-2,2-dimethyl-4-oxoazetidin-3-yl)acetamide (PubChem CID 156519643) has the molecular formula C19H23N7O6S2 and a molecular weight of 509.57 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]-N-(1-hydroxysulfanyloxy-2,2-dimethyl-4-oxoazetidin-3-yl)acetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]-N-(1-hydroxysulfanyloxy-2,2-dimethyl-4-oxoazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 156519643 |
| Molecular Formula | C19H23N7O6S2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]-N-(1-hydroxysulfanyloxy-2,2-dimethyl-4-oxoazetidin-3-yl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCO/N=C(\C(=O)NC2C(=O)N(OSO)C2(C)C)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C19H23N7O6S2/c1-19(2)14(17(28)26(19)32-34-29)24-16(27)13(12-9-33-18(22)23-12)25-31-8-7-30-11-5-3-10(4-6-11)15(20)21/h3-6,9,14,29H,7-8H2,1-2H3,(H3,20,21)(H2,22,23)(H,24,27)/b25-13- |
| InChIKey | ZSFMZTBSNJREMJ-MXAYSNPKSA-N |
| XLogP | 0.97 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|