C19H22N6O8S2 — CID 172967314
[(2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoylphenoxy)ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 172967314) has the molecular formula C19H22N6O8S2 and a molecular weight of 526.55 g/mol. Its IUPAC name is [(2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoylphenoxy)ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [(2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoylphenoxy)ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172967314 |
| Molecular Formula | C19H22N6O8S2 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | [(2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoylphenoxy)ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)c1ccc(OCCO/N=C(\C(=O)C[C@@H]2C(=O)N(OS(=O)(=O)O)[C@@H]2C)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C19H22N6O8S2/c1-10-13(18(27)25(10)33-35(28,29)30)8-15(26)16(14-9-34-19(22)23-14)24-32-7-6-31-12-4-2-11(3-5-12)17(20)21/h2-5,9-10,13H,6-8H2,1H3,(H3,20,21)(H2,22,23)(H,28,29,30)/b24-16-/t10-,13+/m1/s1 |
| InChIKey | HMDBXAIDSQCTKG-PLBQRDCGSA-N |
| XLogP | 0.35 |
| TPSA | 220.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|