C20H24N6O9S2 — CID 172937935
[3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoyl-3-hydroxyphenoxy)ethoxyimino]-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 172937935) has the molecular formula C20H24N6O9S2 and a molecular weight of 556.58 g/mol. Its IUPAC name is [3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoyl-3-hydroxyphenoxy)ethoxyimino]-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoyl-3-hydroxyphenoxy)ethoxyimino]-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172937935 |
| Molecular Formula | C20H24N6O9S2 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | [3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-(4-carbamimidoyl-3-hydroxyphenoxy)ethoxyimino]-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)c1ccc(OCCO/N=C(\C(=O)CC2C(=O)N(OS(=O)(=O)O)C2(C)C)c2csc(N)n2)cc1O |
| InChI | InChI=1S/C20H24N6O9S2/c1-20(2)12(18(29)26(20)35-37(30,31)32)8-15(28)16(13-9-36-19(23)24-13)25-34-6-5-33-10-3-4-11(17(21)22)14(27)7-10/h3-4,7,9,12,27H,5-6,8H2,1-2H3,(H3,21,22)(H2,23,24)(H,30,31,32)/b25-16- |
| InChIKey | LXTNEPKIFMRVAP-XYGWBWBKSA-N |
| XLogP | 0.45 |
| TPSA | 240.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|