C18H21N7O8S2 — CID 78144902
[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 78144902) has the molecular formula C18H21N7O8S2 and a molecular weight of 527.54 g/mol. Its IUPAC name is [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78144902 |
| Molecular Formula | C18H21N7O8S2 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(4-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)c1ccc(OCCON=C(C(=O)NC2C(=O)N(OS(=O)(=O)O)C2C)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C18H21N7O8S2/c1-9-13(17(27)25(9)33-35(28,29)30)23-16(26)14(12-8-34-18(21)22-12)24-32-7-6-31-11-4-2-10(3-5-11)15(19)20/h2-5,8-9,13H,6-7H2,1H3,(H3,19,20)(H2,21,22)(H,23,26)(H,28,29,30) |
| InChIKey | SYZVWJMXJFBLIC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 232.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|