C20H25N7O7S2 — CID 123263206
3-[2-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]ethyl]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 123263206) has the molecular formula C20H25N7O7S2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 3-[2-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]ethyl]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[2-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]ethyl]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 123263206 |
| Molecular Formula | C20H25N7O7S2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 3-[2-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3-carbamimidoylphenoxy)ethoxyimino]acetyl]amino]ethyl]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | [H]/N=C(\N)c1cccc(OCCON=C(C(=O)NCCC2C(=O)N(S(=O)(=O)O)C2C)c2csc(N)n2)c1 |
| InChI | InChI=1S/C20H25N7O7S2/c1-11-14(19(29)27(11)36(30,31)32)5-6-24-18(28)16(15-10-35-20(23)25-15)26-34-8-7-33-13-4-2-3-12(9-13)17(21)22/h2-4,9-11,14H,5-8H2,1H3,(H3,21,22)(H2,23,25)(H,24,28)(H,30,31,32) |
| InChIKey | QCLJVLNKUGJPRX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 223.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|