C20H23N7O8S2 — CID 123217938
3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-carbamimidoyl-2-(formyloxymethyl)phenoxy]ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfinic acid (PubChem CID 123217938) has the molecular formula C20H23N7O8S2 and a molecular weight of 553.58 g/mol. Its IUPAC name is 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-carbamimidoyl-2-(formyloxymethyl)phenoxy]ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfinic acid.
| Compound Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-carbamimidoyl-2-(formyloxymethyl)phenoxy]ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfinic acid |
|---|---|
| PubChem CID | 123217938 |
| Molecular Formula | C20H23N7O8S2 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-carbamimidoyl-2-(formyloxymethyl)phenoxy]ethoxyimino]acetyl]amino]-2-methyl-4-oxoazetidine-1-sulfinic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCON=C(C(=O)NC2C(=O)N(S(=O)O)C2C)c2csc(N)n2)c(COC=O)c1 |
| InChI | InChI=1S/C20H23N7O8S2/c1-10-15(19(30)27(10)37(31)32)25-18(29)16(13-8-36-20(23)24-13)26-35-5-4-34-14-3-2-11(17(21)22)6-12(14)7-33-9-28/h2-3,6,8-10,15H,4-5,7H2,1H3,(H3,21,22)(H2,23,24)(H,25,29)(H,31,32) |
| InChIKey | FDOVNAXKWRSSPU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 232.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|