C17H18N6O9S2 — CID 56613575
(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3,4-dihydroxyanilino)-2-oxoethoxy]iminoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 56613575) has the molecular formula C17H18N6O9S2 and a molecular weight of 514.50 g/mol. Its IUPAC name is (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3,4-dihydroxyanilino)-2-oxoethoxy]iminoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3,4-dihydroxyanilino)-2-oxoethoxy]iminoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 56613575 |
| Molecular Formula | C17H18N6O9S2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(3,4-dihydroxyanilino)-2-oxoethoxy]iminoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](NC(=O)C(=NOCC(=O)Nc2ccc(O)c(O)c2)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C17H18N6O9S2/c1-7-13(16(28)23(7)34(29,30)31)21-15(27)14(9-6-33-17(18)20-9)22-32-5-12(26)19-8-2-3-10(24)11(25)4-8/h2-4,6-7,13,24-25H,5H2,1H3,(H2,18,20)(H,19,26)(H,21,27)(H,29,30,31)/t7-,13-/m0/s1 |
| InChIKey | MQNYYDZDHPQTDU-CPFSXVBKSA-N |
| XLogP | -0.99 |
| TPSA | 233.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|