C9H10N4O6S2 — CID 88511334
(2S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88511334) has the molecular formula C9H10N4O6S2 and a molecular weight of 334.34 g/mol. Its IUPAC name is (2S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88511334 |
| Molecular Formula | C9H10N4O6S2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (2S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C[C@H]1C(NC(=O)C(=O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C9H10N4O6S2/c1-3-5(8(16)13(3)21(17,18)19)12-7(15)6(14)4-2-20-9(10)11-4/h2-3,5H,1H3,(H2,10,11)(H,12,15)(H,17,18,19)/t3-,5?/m0/s1 |
| InChIKey | GMNZSLQNGNIMRD-WWLRPLJCSA-N |
| XLogP | -1.57 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|