C16H16N4O9S2 — CID 5482495
(2S,3S)-3-[[(2E)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 5482495) has the molecular formula C16H16N4O9S2 and a molecular weight of 472.46 g/mol. Its IUPAC name is (2S,3S)-3-[[(2E)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-3-[[(2E)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 5482495 |
| Molecular Formula | C16H16N4O9S2 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (2S,3S)-3-[[(2E)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-thiophen-2-ylacetyl]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](NC(=O)/C(=N\OCc2cc(=O)c(O)cn2O)c2cccs2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C16H16N4O9S2/c1-8-13(16(24)20(8)31(26,27)28)17-15(23)14(12-3-2-4-30-12)18-29-7-9-5-10(21)11(22)6-19(9)25/h2-6,8,13,22,25H,7H2,1H3,(H,17,23)(H,26,27,28)/b18-14-/t8-,13-/m0/s1 |
| InChIKey | GLFCFOMAGGLHCZ-MHPRNXDDSA-N |
| XLogP | -0.71 |
| TPSA | 187.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|