C16H19N7O7S — CID 122674824
(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide (PubChem CID 122674824) has the molecular formula C16H19N7O7S and a molecular weight of 453.44 g/mol. Its IUPAC name is (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide.
| Compound Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 122674824 |
| Molecular Formula | C16H19N7O7S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide |
| SMILES | CON1C(=O)[C@@H](NC(=O)/C(=N\OCc2cc(=O)c(O)cn2O)c2nsc(N)n2)C1(C)C |
| InChI | InChI=1S/C16H19N7O7S/c1-16(2)11(14(27)23(16)29-3)18-13(26)10(12-19-15(17)31-21-12)20-30-6-7-4-8(24)9(25)5-22(7)28/h4-5,11,25,28H,6H2,1-3H3,(H,18,26)(H2,17,19,21)/b20-10-/t11-/m1/s1 |
| InChIKey | AEPKQULCROLCSG-BPXUPMHTSA-N |
| XLogP | -1.19 |
| TPSA | 194.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|