C18H22N6O11S2 — CID 145445416
[3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(1,5-dihydroxy-4-oxo-2-pyridinyl)-2-methoxyethoxy]iminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 145445416) has the molecular formula C18H22N6O11S2 and a molecular weight of 562.54 g/mol. Its IUPAC name is [3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(1,5-dihydroxy-4-oxo-2-pyridinyl)-2-methoxyethoxy]iminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(1,5-dihydroxy-4-oxo-2-pyridinyl)-2-methoxyethoxy]iminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 145445416 |
| Molecular Formula | C18H22N6O11S2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | [3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(1,5-dihydroxy-4-oxo-2-pyridinyl)-2-methoxyethoxy]iminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | COCC(O/N=C(\C(=O)NC1C(=O)N(OS(=O)(=O)O)C1(C)C)c1csc(N)n1)c1cc(=O)c(O)cn1O |
| InChI | InChI=1S/C18H22N6O11S2/c1-18(2)14(16(28)24(18)35-37(30,31)32)21-15(27)13(8-7-36-17(19)20-8)22-34-12(6-33-3)9-4-10(25)11(26)5-23(9)29/h4-5,7,12,14,26,29H,6H2,1-3H3,(H2,19,20)(H,21,27)(H,30,31,32)/b22-13- |
| InChIKey | MKVLRCBEUIQVCQ-XKZIYDEJSA-N |
| XLogP | -1.22 |
| TPSA | 245.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|