C18H29N5O9S2 — CID 172974646
[(3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[3-(ethoxymethoxy)-2-methylbutan-2-yl]oxyiminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 172974646) has the molecular formula C18H29N5O9S2 and a molecular weight of 523.59 g/mol. Its IUPAC name is [(3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[3-(ethoxymethoxy)-2-methylbutan-2-yl]oxyiminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [(3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[3-(ethoxymethoxy)-2-methylbutan-2-yl]oxyiminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172974646 |
| Molecular Formula | C18H29N5O9S2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [(3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[3-(ethoxymethoxy)-2-methylbutan-2-yl]oxyiminoacetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | CCOCOC(C)C(C)(C)O/N=C(\C(=O)N[C@@H]1C(=O)N(OS(=O)(=O)O)C1(C)C)c1csc(N)n1 |
| InChI | InChI=1S/C18H29N5O9S2/c1-7-29-9-30-10(2)18(5,6)31-22-12(11-8-33-16(19)20-11)14(24)21-13-15(25)23(17(13,3)4)32-34(26,27)28/h8,10,13H,7,9H2,1-6H3,(H2,19,20)(H,21,24)(H,26,27,28)/b22-12-/t10?,13-/m1/s1 |
| InChIKey | MZXPSYLCDYRAOO-QMBJOMMRSA-N |
| XLogP | 0.46 |
| TPSA | 191.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|