C17H20N6O7S — CID 122674827
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide (PubChem CID 122674827) has the molecular formula C17H20N6O7S and a molecular weight of 452.45 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 122674827 |
| Molecular Formula | C17H20N6O7S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-N-[(3S)-1-methoxy-2,2-dimethyl-4-oxoazetidin-3-yl]acetamide |
| SMILES | CON1C(=O)[C@@H](NC(=O)/C(=N\OCc2cc(=O)c(O)cn2O)c2csc(N)n2)C1(C)C |
| InChI | InChI=1S/C17H20N6O7S/c1-17(2)13(15(27)23(17)29-3)20-14(26)12(9-7-31-16(18)19-9)21-30-6-8-4-10(24)11(25)5-22(8)28/h4-5,7,13,25,28H,6H2,1-3H3,(H2,18,19)(H,20,26)/b21-12-/t13-/m1/s1 |
| InChIKey | VGPIUHSSVHRICO-MUBJSKCLSA-N |
| XLogP | -0.58 |
| TPSA | 181.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|