C13H16N6O8S3 — CID 173378200
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173378200) has the molecular formula C13H16N6O8S3 and a molecular weight of 480.51 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173378200 |
| Molecular Formula | C13H16N6O8S3 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(OS(C)(=O)=O)(C(=O)O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C13H16N6O8S3/c1-26-17-5(7-16-12(14)29-18-7)8(20)15-6-9(21)19-3-13(11(22)23,4-28-10(6)19)27-30(2,24)25/h6,10H,3-4H2,1-2H3,(H,15,20)(H,22,23)(H2,14,16,18)/t6?,10-,13?/m1/s1 |
| InChIKey | YBLAWUBZIWBLAH-PNIFCMSSSA-N |
| XLogP | -2.33 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|