C31H26N8O5S4 — CID 173323263
benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173323263) has the molecular formula C31H26N8O5S4 and a molecular weight of 718.87 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173323263 |
| Molecular Formula | C31H26N8O5S4 |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.09 |
| IUPAC Name | benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(Sc3nc4cccnc4s3)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C31H26N8O5S4/c1-43-37-20(23-36-29(32)48-38-23)24(40)35-21-26(41)39-15-31(16-45-27(21)39,47-30-34-19-13-8-14-33-25(19)46-30)28(42)44-22(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,21-22,27H,15-16H2,1H3,(H,35,40)(H2,32,36,38)/t21?,27-,31?/m1/s1 |
| InChIKey | PUVMZXQTANYNQI-RNBQXIHISA-N |
| XLogP | 3.74 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|