C26H23IN6O5S2 — CID 154413557
benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154413557) has the molecular formula C26H23IN6O5S2 and a molecular weight of 690.55 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413557 |
| Molecular Formula | C26H23IN6O5S2 |
| Molecular Weight | 690.55 g/mol |
| Exact Mass | 690.02 |
| IUPAC Name | benzhydryl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CI)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C26H23IN6O5S2/c1-37-31-17(21-30-26(28)40-32-21)22(34)29-18-23(35)33-19(16(12-27)13-39-24(18)33)25(36)38-20(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,18,20,24H,12-13H2,1H3,(H,29,34)(H2,28,30,32)/t18?,24-/m1/s1 |
| InChIKey | ZIUITQRCAUKRNQ-VCUSLETLSA-N |
| XLogP | 2.89 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|