C29H26N6O6S2 — CID 10817629
benzhydryl (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-(3-hydroxyprop-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10817629) has the molecular formula C29H26N6O6S2 and a molecular weight of 618.70 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-(3-hydroxyprop-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-(3-hydroxyprop-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10817629 |
| Molecular Formula | C29H26N6O6S2 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-(3-hydroxyprop-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(C#CCO)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C29H26N6O6S2/c1-2-40-33-20(24-32-29(30)43-34-24)25(37)31-21-26(38)35-22(19(14-9-15-36)16-42-27(21)35)28(39)41-23(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,21,23,27,36H,2,15-16H2,1H3,(H,31,37)(H2,30,32,34)/b33-20-/t21-,27-/m1/s1 |
| InChIKey | ISUMHLGZEZIYQU-MNEBDRCSSA-N |
| XLogP | 1.84 |
| TPSA | 169.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|