C22H22N6O8S3 — CID 88600914
(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(E)-2-(4-methylphenyl)sulfonyloxyethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88600914) has the molecular formula C22H22N6O8S3 and a molecular weight of 594.65 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(E)-2-(4-methylphenyl)sulfonyloxyethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(E)-2-(4-methylphenyl)sulfonyloxyethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88600914 |
| Molecular Formula | C22H22N6O8S3 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(E)-2-(4-methylphenyl)sulfonyloxyethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(/C=C/OS(=O)(=O)c3ccc(C)cc3)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C22H22N6O8S3/c1-3-35-26-14(17-25-22(23)38-27-17)18(29)24-15-19(30)28-16(21(31)32)12(10-37-20(15)28)8-9-36-39(33,34)13-6-4-11(2)5-7-13/h4-9,15,20H,3,10H2,1-2H3,(H,24,29)(H,31,32)(H2,23,25,27)/b9-8+,26-14-/t15?,20-/m1/s1 |
| InChIKey | VTEGOBZXUGYBOW-WCHXSFPASA-N |
| XLogP | 0.83 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|