C15H16N6O8S3 — CID 57019905
(6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57019905) has the molecular formula C15H16N6O8S3 and a molecular weight of 504.53 g/mol. Its IUPAC name is (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57019905 |
| Molecular Formula | C15H16N6O8S3 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(OS(C)(=O)=O)CS[C@@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C15H16N6O8S3/c1-3-4-28-19-7(10-18-15(16)31-20-10)11(22)17-8-12(23)21-9(14(24)25)6(5-30-13(8)21)29-32(2,26)27/h3,8,13H,1,4-5H2,2H3,(H,17,22)(H,24,25)(H2,16,18,20)/t8?,13-/m0/s1 |
| InChIKey | XDTMSNWYKNOHJP-RLROJCQXSA-N |
| XLogP | -1.30 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|