C14H14N6O5S2 — CID 173412246
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid (PubChem CID 173412246) has the molecular formula C14H14N6O5S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 173412246 |
| Molecular Formula | C14H14N6O5S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
| SMILES | C=CCON=C(C(=O)NC1C(=O)N2C=C(C(=O)O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C14H14N6O5S2/c1-2-3-25-18-7(9-17-14(15)27-19-9)10(21)16-8-11(22)20-4-6(13(23)24)5-26-12(8)20/h2,4,8,12H,1,3,5H2,(H,16,21)(H,23,24)(H2,15,17,19)/t8?,12-/m1/s1 |
| InChIKey | KWQMJPZWXSOBHK-LESKNEHBSA-N |
| XLogP | -0.60 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|