C18H18N8O5S4 — CID 173387301
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173387301) has the molecular formula C18H18N8O5S4 and a molecular weight of 554.66 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173387301 |
| Molecular Formula | C18H18N8O5S4 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.03 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-enoxyiminoacetyl]amino]-8-oxo-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | C=CCON=C(C(=O)NC1C(=O)N2CC(C=CSc3nncs3)(C(=O)O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C18H18N8O5S4/c1-2-4-31-24-9(11-22-16(19)35-25-11)12(27)21-10-13(28)26-6-18(15(29)30,7-33-14(10)26)3-5-32-17-23-20-8-34-17/h2-3,5,8,10,14H,1,4,6-7H2,(H,21,27)(H,29,30)(H2,19,22,25)/t10?,14-,18?/m1/s1 |
| InChIKey | AMDIECCEIDWYMC-MJFHRTCQSA-N |
| XLogP | 0.66 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|