C20H25N9O6S4 — CID 173412321
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[2-(diethylamino)-2-oxoethoxy]iminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173412321) has the molecular formula C20H25N9O6S4 and a molecular weight of 615.75 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[2-(diethylamino)-2-oxoethoxy]iminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[2-(diethylamino)-2-oxoethoxy]iminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173412321 |
| Molecular Formula | C20H25N9O6S4 |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.08 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[2-(diethylamino)-2-oxoethoxy]iminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CCN(CC)C(=O)CON=C(C(=O)NC1C(=O)N2CC(CSc3nncs3)(C(=O)O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C20H25N9O6S4/c1-3-28(4-2)10(30)5-35-26-11(13-24-18(21)39-27-13)14(31)23-12-15(32)29-6-20(17(33)34,7-36-16(12)29)8-37-19-25-22-9-38-19/h9,12,16H,3-8H2,1-2H3,(H,23,31)(H,33,34)(H2,21,24,27)/t12?,16-,20?/m1/s1 |
| InChIKey | GFKOXFHTPLNWEN-WCKOCXJASA-N |
| XLogP | -0.18 |
| TPSA | 206.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|