C17H20N8O5S5 — CID 173411664
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[5-(methylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173411664) has the molecular formula C17H20N8O5S5 and a molecular weight of 576.73 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[5-(methylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[5-(methylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173411664 |
| Molecular Formula | C17H20N8O5S5 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[5-(methylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(CSc3nnc(CSC)s3)(C(=O)O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C17H20N8O5S5/c1-30-23-8(10-20-15(18)35-24-10)11(26)19-9-12(27)25-4-17(14(28)29,5-32-13(9)25)6-33-16-22-21-7(34-16)3-31-2/h9,13H,3-6H2,1-2H3,(H,19,26)(H,28,29)(H2,18,20,24)/t9?,13-,17?/m1/s1 |
| InChIKey | DUMQYQZRCBNTEW-ZQGOXVPYSA-N |
| XLogP | 0.45 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|