C19H25N9O6S3 — CID 173411758
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173411758) has the molecular formula C19H25N9O6S3 and a molecular weight of 571.67 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173411758 |
| Molecular Formula | C19H25N9O6S3 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | COCCCn1cnnc1SCC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOC)c3nsc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C19H25N9O6S3/c1-33-5-3-4-27-9-21-24-18(27)36-8-19(16(31)32)6-28-14(30)11(15(28)35-7-19)22-13(29)10(25-34-2)12-23-17(20)37-26-12/h9,11,15H,3-8H2,1-2H3,(H,22,29)(H,31,32)(H2,20,23,26)/t11?,15-,19?/m1/s1 |
| InChIKey | XPECNCNFBDNFEL-MAJVRLLFSA-N |
| XLogP | -0.64 |
| TPSA | 200.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|